4-Trifluoromethylumbelliferyl b-D-glucuronide potassium salt
4-Trifluoromethylumbelliferyl b-D-glucuronide potassium salt is a potent fluorescent substrate used in biomedicine to identify certain enzymes involved in drug metabolism. It specifically detects β-glucuronidase activity, an enzyme associated with various drug and disease metabolisms.
| Supplier | BOC Sciences |
|---|---|
| Product # | 143547-78-8 |
| Pricing | Inquire |
| Cas | 143547-78-8 |
| Molecular Weight | 444.35 |
| Molecular Formula | C16H12F3O9K |
| Canonical SMILES | C1=CC2=C(C=C1OC3C(C(C(C(O3)C(=O)[O-])O)O)O)OC(=O)C=C2C(F)(F)F.[K+] |