Oroxylin A
Oroxylin A is a natural flavonoid found in the seeds of Oraxylum indicum (L.) Kurz. Oroxylin A exhibits anti-inflammation activity, it can inhibit LPS-induced iNOS and COX-2 gene expression by blocking NF-κB activation. Oroxylin A also has the activities
| Supplier | BOC Sciences |
|---|---|
| Product # | NP1905 |
| Pricing | Inquire |
| Cas | 480-11-5 |
| Molecular Weight | 284.26 |
| Molecular Formula | C16H12O5 |
| Canonical SMILES | COC1=C(C=C2C(=C1O)C(=O)C=C(O2)C3=CC=CC=C3)O |