β-amyloid 12-28
Amyloid β-Peptide (12-28) (human) is the human form of Amyloid β-peptide fragment. It is the minimum section required to bind to brain proteins. It binds to α7-nicotinic ACh receptors with high affinity. It also impairs memory retention following central administration in mice in vivo.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-010687 |
| Pricing | Inquire |
| Cas | 107015-83-8 |
| Molecular Weight | 1955.20 |
| Molecular Formula | C89H135N25O25 |
| Canonical SMILES | CC(C)CC(C(=O)NC(C(C)C)C(=O)NC(CC1=CC=CC=C1)C(=O)NC(CC2=CC=CC=C2)C(=O)NC(C)C(=O)NC(CCC(=O)O)C(=O)NC(CC(=O)O)C(=O)NC(C(C)C)C(=O)NCC(=O)NC(CO)C(=O)NC(CC(=O)N)C(=O)NC(CCCCN)C(=O)O)NC(=O)C(CCCCN)NC(=O)C(CCC(=O)N)NC(=O)C(CC3=CNC=N3)NC(=O)C(CC4=CNC=N4)NC(=O)C(C(C)C)N |