1-(alpha-L-Threofuranosyl)thymine
1-(alpha-L-Threofuranosyl)thymine is an analogue nucleoside with powerful antiviral properties, making it the ideal drug for treating herpes simplex virus and varicella-zoster virus infections. Its mechanism of action is remarkably sophisticated, as it irreversibly inhibits viral DNA polymerase, reducing viral replication and thereby suppressing viral load with utmost efficiency.
| Supplier | BOC Sciences |
|---|---|
| Product # | 325683-84-9 |
| Pricing | Inquire |
| Cas | 325683-84-9 |
| Molecular Weight | 228.20 |
| Molecular Formula | C9H12N2O5 |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2C(C(CO2)O)O |