2,3-Di-O-benzyl-4,6-O-ethylidene-D-glucopyranose
2,3-Di-O-benzyl-4,6-O-ethylidene-D-glucopyranose, an esteemed compound of immense significance in the realm of biomedicine, has garnered attention due to its inherent potential for multifaceted applications. Widely employed in the synthesis of pharmaceutical drugs, this compound holds immense promise in combating a diverse array of ailments.
| Supplier | BOC Sciences |
|---|---|
| Product # | 471863-88-4 |
| Pricing | Inquire |
| Cas | 471863-88-4 |
| Molecular Weight | 386.44 |
| Molecular Formula | C22H26O6 |
| Canonical SMILES | CC1OCC2C(O1)C(C(C(O2)O)OCC3=CC=CC=C3)OCC4=CC=CC=C4 |