Progesterone EP Impurity E

An impurity of Progesterone.Progesterone is an endogenous steroid and progestogen sex hormone involved in the menstrual cycle, pregnancy, and embryogenesis of humans and other species. Progesterone is also a crucial metabolic intermediate in the production of other endogenous steroids, including the sex hormones and the corticosteroids, and plays an important role in brain function as a neurosteroid.
Supplier BOC Sciences
Product # 5062-62-4
Pricing Inquire
Cas 5062-62-4
Molecular Weight 358.53
Molecular Formula C23H34O3
Canonical SMILES CC(C1CCC2C1(CCC3C2CCC4=CC(=O)CCC34C)C)OC(=O)C
Feedback