Progesterone EP Impurity E
An impurity of Progesterone.Progesterone is an endogenous steroid and progestogen sex hormone involved in the menstrual cycle, pregnancy, and embryogenesis of humans and other species. Progesterone is also a crucial metabolic intermediate in the production of other endogenous steroids, including the sex hormones and the corticosteroids, and plays an important role in brain function as a neurosteroid.
Supplier | BOC Sciences |
---|---|
Product # | 5062-62-4 |
Pricing | Inquire |
Cas | 5062-62-4 |
Molecular Weight | 358.53 |
Molecular Formula | C23H34O3 |
Canonical SMILES | CC(C1CCC2C1(CCC3C2CCC4=CC(=O)CCC34C)C)OC(=O)C |