Rhodamine B
Rhodamine B is a tracer dye within water to determine the rate and direction of flow and transport. Rhodamine dyes fluoresce and thus can be detected easily with instruments called fluorometers. Rhodamine dyes are used extensively in biotechnology applications such as fluorescence microscopy, flow cytometry, fluorescence correlation spectroscopy and ELISA.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP0547 |
| Pricing | Inquire |
| Cas | 81-88-9 |
| Molecular Weight | 479.01 |
| Molecular Formula | C28H31ClN2O3 |
| Canonical SMILES | CCN(CC)C1=CC2=C(C=C1)C(=C3C=CC(=[N+](CC)CC)C=C3O2)C4=CC=CC=C4C(=O)O.[Cl-] |