2'-O-tert-Butyldimethylsilyl-N2-isobutyrylguanosine
2'-O-tert-Butyldimethylsilyl-N2-isobutyrylguanosine, a vital reagent in the biomedical sector, holds immense significance for synthesizing diverse antiviral medications. Its unparalleled structure and mechanism of action contribute significantly to combating viral infections like hepatitis C and HIV.
| Supplier | BOC Sciences |
|---|---|
| Product # | 182007-86-9 |
| Pricing | Inquire |
| Cas | 182007-86-9 |
| Molecular Weight | 467.59 |
| Molecular Formula | C20H33N5O6Si |
| Canonical SMILES | CC(C)C(=O)NC1=NC2=C(C(=O)N1)N=CN2C3C(C(C(O3)CO)O)O[Si](C)(C)C(C)(C)C |