(3R,4'S)-Benidipine HCl
(3R,4'S)-Benidipine HCl is a calcium channel blocker utilized in the biomedical industry to study hypertension and angina. It inhibits the influx of calcium ions into smooth muscle cells, leading to vasodilation and decreased cardiac workload.
| Supplier | BOC Sciences |
|---|---|
| Product # | 119065-61-1 |
| Pricing | Inquire |
| Cas | 119065-61-1 |
| Molecular Weight | 542.04 |
| Molecular Formula | C28H32N3O6Cl |
| Canonical SMILES | CC1=C(C(C(=C(N1)C)C(=O)OC2CCCN(C2)CC3=CC=CC=C3)C4=CC(=CC=C4)[N+](=O)[O-])C(=O)OC |