(2',3',5'-Tri-O-acetyl)uridine 5-carboxylic acid
(2',3',5'-Tri-O-acetyl)uridine 5-carboxylic acid, a chemical compound with immense biomedical significance, has been welcomed as a potential remedy for viral infections, cancer, and neurological disorders. Its efficacy against herpes simplex virus type-1 and type-2 has been documented, along with its potent cytotoxic effects on various cancer cell lines. The therapeutic applications of (2',3',5'-Tri-O-acetyl)uridine 5-carboxylic acid for multiple sclerosis, Alzheimer's disease, and Parkinson's disease are also significant. This very compound is redrawing boundaries in the sphere of biomedicine with its multifaceted pharmacological actions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 174653-39-5 |
| Pricing | Inquire |
| Cas | 174653-39-5 |
| Molecular Weight | 414.32 |
| Molecular Formula | C16H18N2O11 |
| Canonical SMILES | CC(=O)OCC1C(C(C(O1)N2C=C(C(=O)NC2=O)C(=O)O)OC(=O)C)OC(=O)C |