N-Methyl-3-indolyl b-D-galactopyranoside monohydrate
N-Methyl-3-indolyl b-D-galactopyranoside monohydrate, a chemical compound utilized in bacterial research, serves as a substrate for beta-galactosidase, producing a distinct blue hue. This compound is widely applied in molecular biology experiments for screening purposes, detecting recombinant plasmids and genetic modifications in bacteria colonies, aiding in the study of lacZ gene activity.
| Supplier | BOC Sciences |
|---|---|
| Product # | 207598-26-3 |
| Pricing | Inquire |
| Cas | 207598-26-3 |
| Molecular Weight | 327.33 |
| Molecular Formula | C15H21NO7 |
| Canonical SMILES | CN1C=C(C2=CC=CC=C21)OC3C(C(C(C(O3)CO)O)O)O |