Destruxin A
Destruxin A, a sort of cyclic hexadepsipeptide mycotoxin, could be obtained from entomopathogenic fungi and has been found to exhibit activities in restraining leukemic cell proliferation and insect immune response at some extent.
Supplier | BOC Sciences |
---|---|
Product # | 6686-70-0 |
Pricing | Inquire |
Cas | 6686-70-0 |
Molecular Weight | 577.71 |
Molecular Formula | C29H47N5O7 |
Canonical SMILES | CCC(C)C1C(=O)N(C(C(=O)N(C(C(=O)NCCC(=O)OC(C(=O)N2CCCC2C(=O)N1)CC=C)C)C)C(C)C)C |