4-Methylumbelliferyl-b-D-xylotrioside
4-Methylumbelliferyl-b-D-xylotrioside is a fascinating biochemical recompound widely employed in the research of beta-xylosidase enzymes' activity. As a versatile tool, it can use in the research of enigmatic ailments like Schindler disease, mucopolysaccharidosis IIIC is and Gaucher disease.
| Supplier | BOC Sciences |
|---|---|
| Product # | 250252-60-9 |
| Pricing | Inquire |
| Cas | 250252-60-9 |
| Molecular Weight | 572.51 |
| Molecular Formula | C25H32O15 |
| Canonical SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)OC3C(C(C(CO3)OC4C(C(C(CO4)OC5C(C(C(CO5)O)O)O)O)O)O)O |