5-Formyl-CTP
5-Formyl-CTP is a paramount compound, holding great significance for elucidating RNA metabolism and signaling pathways. Functioning as a modified nucleotide, it actively participates in RNA formation as a substrate during transcription. By facilitating the exploration of RNA processing, modifications and diverse cellular processes such as gene expression and regulation, this compound serves as a powerful tool for comprehensive studies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1428903-58-5 |
| Pricing | Inquire |
| Cas | 1428903-58-5 |
| Molecular Weight | 511.17 |
| Molecular Formula | C10H16N3O15P3 |
| Canonical SMILES | C1=C(C(=NC(=O)N1C2C(C(C(O2)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N)C=O |