7-Ketodeoxycholic acid
7-Ketodeoxycholic acid is a bile acid. Bile acids are physiological detergents that facilitate excretion, absorption, and transport of fats and sterols in the intestine and liver. Bile acids are also steroidal amphipathic molecules derived from the catabolism of cholesterol.
| Supplier | BOC Sciences |
|---|---|
| Product # | 911-40-0 |
| Pricing | Inquire |
| Cas | 911-40-0 |
| Molecular Weight | 406.56 |
| Molecular Formula | C24H38O5 |
| Canonical SMILES | CC(CCC(=O)O)C1CCC2C1(C(CC3C2C(=O)CC4C3(CCC(C4)O)C)O)C |