Blood Group B trisaccharide-(CH2)8COOMe derivative
Blood Group B Trisaccharide-(CH2)8COOMe Derivative: A pivotal compound extensively utilized in the biomedical sector for the exploration of blood group antigen systems and associated pathologies. Renowned for its unique and tailored molecular arrangement, this compound plays a crucial role in the discernment and demarcation of blood group B antigens, fostering exploration of blood transfusion compatibility and autoimmune ailments.
| Supplier | BOC Sciences |
|---|---|
| Product # | 65606-80-6 |
| Pricing | Inquire |
| Cas | 65606-80-6 |
| Molecular Weight | 658.69 |
| Molecular Formula | C28H50O17 |
| Canonical SMILES | CC1C(C(C(C(O1)OC2C(C(C(OC2OCCCCCCCCC(=O)O)CO)O)OC3C(C(C(C(O3)CO)O)O)O)O)O)O |