Pneumocandin A0
Pneumocandin A0 is a lipopeptide antibiotic produced by Zalerion arboricola. It has a strong anti-Candida effect. It has the effect of inhibiting the synthesis of 1,3 early-glucan in vitro, with an IC50 of 0.07-0.5 μg/mL. Pneumocandin A0 is an impurity of Micafungin.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02575 |
| Pricing | Inquire |
| Cas | 120692-19-5 |
| Molecular Weight | 1079.24 |
| Molecular Formula | C51H82N8O17 |
| Canonical SMILES | CCC(C)CC(C)CCCCCCCCC(=O)NC1CC(C(NC(=O)C2C(C(CN2C(=O)C(NC(=O)C(NC(=O)C3CC(CN3C(=O)C(NC1=O)C(C)O)O)C(C(C4=CC=C(C=C4)O)O)O)C(CC(=O)N)O)C)O)O)O |