2-Amino-9-(3-deoxy-3-fluoro-beta-D-ribofuranosyl)-9H-purine
2-Amino-9-(3-deoxy-3-fluoro-beta-D-ribofuranosyl)-9H-purine is used in the biomedical industry as an antiviral drug, specifically to treat hepatitis B and C. It works by inhibiting the replication of the virus, preventing its spread and reducing the severity of the disease. Its mechanism of action involves incorporation into the viral DNA, leading to premature termination of viral replication.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1612192-04-7 |
| Pricing | Inquire |
| Cas | 1612192-04-7 |
| Molecular Weight | 269.23 |
| Molecular Formula | C10H12FN5O3 |
| Canonical SMILES | C1=C2C(=NC(=N1)N)N(C=N2)C3C(C(C(O3)CO)F)O |