5-Bromo-6-chloro-3-indolyl b-D-glucuronide
5-Bromo-6-chloro-3-indolyl b-D-glucuronide is a chemical compound widely used in the biomedicine industry. It is primarily employed as a substrate in lab experiments to detect the presence of β-glucuronidase. This enzyme is crucial for investigating drug metabolism and detecting certain diseases, such as bladder cancer and hereditary diseases like Sly syndrome.
| Supplier | BOC Sciences |
|---|---|
| Product # | 144110-42-9 |
| Pricing | Inquire |
| Cas | 144110-42-9 |
| Molecular Weight | 422.61 |
| Molecular Formula | C14H13BrClNO7 |
| Canonical SMILES | C1=C2C(=CC(=C1Br)Cl)NC=C2OC3C(C(C(C(O3)C(=O)O)O)O)O |