eIF4A3-IN-1
eIF4A3-IN-1 is a selective eukaryotic initiation factor 4A3 (eIF4A3) inhibitor. It binds to a non-ATP binding site of eIF4A3 and shows significant cellular nonsense-mediated RNA decay (NMD) inhibition at 10 and 3 μM and can be as a probe for further study of eIF4A3, the exon junction complex (EJC), and NMD.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2095486-67-0 |
| Pricing | Inquire |
| Cas | 2095486-67-0 |
| Molecular Weight | 588.88 |
| Molecular Formula | C29H23BrClN5O2 |
| Canonical SMILES | CC1=C(C=NN1C2=CC=CC(=C2)C#N)C(=O)N3CCN(C(C3)C4=CC=C(C=C4)Cl)C(=O)C5=CC=C(C=C5)Br |