5'-O-DMT-2'-O-iBu-N-Bz-Guanosine
5'-O-DMT-2'-O-iBu-N-Bz-Guanosine, an indispensable compound utilized in the biomedical sector, showcases immense promise in combatting a plethora of diseases and disorders, namely cancer and viral infections. Its extraordinary configuration empowers it to disrupt replication procedures, rendering it a highly efficacious agent against antiviral and anticancer fronts.
| Supplier | BOC Sciences |
|---|---|
| Product # | 81279-39-2 |
| Pricing | Inquire |
| Cas | 81279-39-2 |
| Molecular Weight | 769.96 |
| Molecular Formula | C41H51N5O8Si |
| Canonical SMILES | CC(C)C(=O)NC1=NC2=C(C(=O)N1)N=CN2C3C(C(C(O3)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC)O)O[Si](C)(C)C(C)(C)C |