Drimentine B
It is produced by the strain of Actinomycete strain MST-8651. It belongs to a novel class of antibiotics, possessing a new terpenylated diketopiperazine structure, with antibacterial, antifungal and anthelmintic activity.
Supplier | BOC Sciences |
---|---|
Product # | BBF-04228 |
Pricing | Inquire |
Cas | 204398-91-4 |
Molecular Weight | 485.66 |
Molecular Formula | C31H39N3O2 |
Canonical SMILES | CC1(CCCC2(C1CCC(=C)C2CC34CC5C(=O)N6CCC=C6C(=O)N5C3NC7=CC=CC=C47)C)C |