Fmoc-4-Borono-L-Phenylalanine
Fmoc-4-Borono-L-Phenylalanine, a derivative of amino acid utilized for peptide synthesis and asymmetric synthesis catalysis, has garnered significant interest due to its promising therapeutic effects on cancer and diabetes. Numerous studies have been conducted on this compound to explore its potential for treating these diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-008403 |
| Pricing | Inquire |
| Cas | 273221-71-9 |
| Molecular Weight | 431.2 |
| Molecular Formula | C24H22BNO6 |
| Canonical SMILES | B(C1=CC=C(C=C1)CC(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)(O)O |