1-Deoxy-D-xylulose 5-phosphate
1-Deoxy-D-xylulose 5-phosphate is a biosynthetic precursor to isopentenyl pyrophosphate and other terpenoids in certain bacteria and plants. This compound has applications in research of anti-malaria treatments, given its role in the metabolic pathway of Plasmodium parasites, which cause malaria.
| Supplier | BOC Sciences |
|---|---|
| Product # | 190079-18-6 |
| Pricing | Inquire |
| Cas | 190079-18-6 |
| Molecular Weight | 214.11 |
| Molecular Formula | C5H11O7P |
| Canonical SMILES | CC(=O)C(C(COP(=O)(O)O)O)O |