A 987306
A 987306 is a potent histamine H4 receptor antagonist (pKi = 8.24 and 8.47 in human and rat H4 receptors, respectively) with 162-, 620-, and > 1600-fold selectivity over human H3, H1 and H2 receptors. It suppresses zymosan-induced neutrophil reflux and attenuates thermal hypersensitivity in vivo (ED50 = 42 μmol/kg, ip).
| Supplier | BOC Sciences |
|---|---|
| Product # | 1082954-71-9 |
| Pricing | Inquire |
| Cas | 1082954-71-9 |
| Molecular Weight | 327.42 |
| Molecular Formula | C18H25N5O |
| Canonical SMILES | C1CCC2C(C1)C3=C(O2)CCC4=C3N=C(N=C4N5CCNCC5)N |