2-(Acetylamino)-2-deoxy-3-O-benzoyl-4,6-O-[(S)-benzylidene]-D-galactopyranose Trichloroacetimidate
2-(Acetylamino)-2-deoxy-3-O-benzoyl-4,6-O-[(S)-benzylidene]-D-galactopyranose Trichloroacetimidate is a valuable intermediate extensively used in the synthesis of novel drugs. It plays a crucial role in the biomedical industry by serving as a key building block for the development of antiviral agents, protease inhibitors, and drugs targeting carbohydrate-binding proteins. Additionally, this compound finds applications in research of various diseases such as HIV/AIDS, hepatitis, and cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | 390400-47-2 |
| Pricing | Inquire |
| Cas | 390400-47-2 |
| Molecular Weight | 557.81 |
| Molecular Formula | C24H23Cl3N2O7 |
| Canonical SMILES | CC(=O)NC1C(C2C(COC(O2)C3=CC=CC=C3)OC1OC(=N)C(Cl)(Cl)Cl)OC(=O)C4=CC=CC=C4 |