5(6)-TAMRA cadaverine
5(6)-TAMRA cadaverine is an analog of orange-fluorescent 5(6)-TAMRA, which is coupled to aldehydes and ketones to yield a reversible Schiff Base product that can be transformed to a stable amine derivative using a reducing agent like sodium borohydride or sodium cyanoborohydride. The primary amine may also be reacted with carboxylic acids on peptides, proteins, and and other biomolecules using a carbodiimide coupling agent like EDAC or DIPC.
| Supplier | BOC Sciences |
|---|---|
| Product # | 159311-67-8 |
| Pricing | Inquire |
| Cas | 159311-67-8 |
| Molecular Weight | 514.62 |
| Molecular Formula | C30H34N4O4 |
| Canonical SMILES | CN(C)C1=CC2=C(C=C1)C(=C3C=CC(=[N+](C)C)C=C3O2)C4=C(C=C(C=C4)C(=O)NCCCCCN)C(=O)[O-].CN(C)C1=CC2=C(C=C1)C(=C3C=CC(=[N+](C)C)C=C3O2)C4=C(C=CC(=C4)C(=O)NCCCCCN)C(=O)[O-] |