Ulixertinib HCl
Ulixertinib, also known as BVD-523 and VRT752271 is a potent and reversible ERK1/ERK2 inhibitor with IC50 of <0.3 nM for ERK2. Upon oral administration, BVD-523 inhibits both ERK 1 and 2, thereby preventing the activation of ERK-mediated signal transduction pathways. This results in the inhibition of ERK-dependent tumor cell proliferation and survival.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1956366-10-1 |
| Pricing | Inquire |
| Cas | 1956366-10-1 |
| Molecular Weight | 469.79 |
| Molecular Formula | C21H23Cl3N4O2 |
| Canonical SMILES | O=C(C1=CC(C2=CC(NC(C)C)=NC=C2Cl)=CN1)N[C@@H](C3=CC=CC(Cl)=C3)CO.[H]Cl |