Marasmic acid
It is produced by the strain of Marasmius conigenus 6890. It's a terpene antibiotic. It has anti-gram-positive bacteria effect. It also has anti-gram-negative bacteria, mycobacteria and fungi effect, but the effect is weak.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02298 |
| Pricing | Inquire |
| Cas | 2212-99-9 |
| Molecular Weight | 262.30 |
| Molecular Formula | C15H18O4 |
| Canonical SMILES | CC1(CC2C=C(C34CC3(C2C1)C(=O)OC4O)C=O)C |