N6-Benzoyl-9-(2'-deoxy-5'-O-DMT-2'-fluoro-b-D-arabinofuranosyl)adenine

N6-Benzoyl-9-(2'-deoxy-5'-O-DMT-2'-fluoro-b-D-arabinofuranosyl)adenine is a potent antiviral drug specifically used in the treatment of various viral infections. It exhibits remarkable activity against various DNA viruses, including herpes simplex virus and varicella-zoster virus. This product acts by inhibiting viral DNA synthesis and effectively reducing the viral load, thus aiding in the management of viral diseases.
Supplier BOC Sciences
Product # 226415-08-3
Pricing Inquire
Cas 226415-08-3
Molecular Weight 675.71
Molecular Formula C38H34FN5O6
Canonical SMILES COC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)OCC4C(C(C(O4)N5C=NC6=C(N=CN=C65)NC(=O)C7=CC=CC=C7)F)O
Feedback