Cyanine7.5 NHS ester
Cyanine7.5 is a NIR dye with very long-wave emission. This product is amine-reactive derivative of this fluorophore.Near infrared radiation readily penetrates tissues and can be used for imaging applications in vivo.
| Supplier | BOC Sciences |
|---|---|
| Product # | R01-0023 |
| Pricing | Inquire |
| Molecular Weight | 833.76 |
| Molecular Formula | C49H52N3BF4O4 |
| Canonical SMILES | B(F)(F)F.CC1(C(=[N+](C2=C1C3=CC=CC=C3C=C2)C)C=CC4=CC(=CC=C5C(C6=C(N5CCCCCC(=O)ON7C(=O)CCC7=O)C=CC8=CC=CC=C86)(C)C)CCC4)C.[F-] |