Hexa-L-Tyrosine
Hexa-L-Tyrosine, a molecule frequently employed in the creation of peptide-based therapeutic treatments for afflictions such as cancer and neurodegenerative conditions, possesses potent antioxidant capabilities. It may also serve as a fundamental unit in the assembly of peptides displaying enhanced pharmacologically relevant traits.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-015250 |
| Pricing | Inquire |
| Cas | 6934-38-9 |
| Molecular Weight | 997.05 |
| Molecular Formula | C54H56N6O13 |
| Canonical SMILES | C1=CC(=CC=C1CC(C(=O)NC(CC2=CC=C(C=C2)O)C(=O)NC(CC3=CC=C(C=C3)O)C(=O)NC(CC4=CC=C(C=C4)O)C(=O)NC(CC5=CC=C(C=C5)O)C(=O)NC(CC6=CC=C(C=C6)O)C(=O)O)N)O |