4-Nitrophenyl b-D-cellotrioside
4-Nitrophenyl b-D-cellotrioside is a biomedical compound used in the study of enzyme kinetics and drug design for studying diseases such as cancer and infectious diseases. It acts as a substrate for enzymes involved in carbohydrate metabolism. Its nitrophenyl group enhances detection sensitivity in various assays aiding in drug discovery and development in the biomedical industry.
| Supplier | BOC Sciences |
|---|---|
| Product # | 106927-48-4 |
| Pricing | Inquire |
| Cas | 106927-48-4 |
| Molecular Weight | 625.53 |
| Molecular Formula | C24H35NO18 |
| Canonical SMILES | C1=CC(=CC=C1[N+](=O)[O-])OC2C(C(C(C(O2)CO)OC3C(C(C(C(O3)CO)OC4C(C(C(C(O4)CO)O)O)O)O)O)O)O |