rac trans-4-Hydroxy Glyburide
rac trans-4-Hydroxy Glyburide is a compound implemented extensively within the biomedical research, used for studying afflictions pertaining to type 2 diabetes. Functioning as a hypoglycemic agent, this awe-inspiring compound exhibits unmatched aptitude in bolstering insulin secretion.
| Supplier | BOC Sciences |
|---|---|
| Product # | 23155-04-6 |
| Pricing | Inquire |
| Cas | 23155-04-6 |
| Molecular Weight | 510.01 |
| Molecular Formula | C23H28ClN3O6S |
| Canonical SMILES | COC1=C(C=C(C=C1)Cl)C(=O)NCCC2=CC=C(C=C2)S(=O)(=O)NC(=O)NC3CCC(CC3)O |