Ethyl 6-Fluoroindole-2-carboxylate
N-Boc-4-oxo-L-proline was used as a reactant in the synthesis of benzidine and diaminofluorene prolinamide derivatives which are highly potent inhibitors of hepatitis C virus. Also used in the preparation of heterodimeric antagonists which diplay potent antiproliferative activities and have potential for further investigation.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB022315 |
| Pricing | Inquire |
| Cas | 348-37-8 |
| Molecular Weight | 207.20 |
| Molecular Formula | C11H10FNO2 |
| Canonical SMILES | CCOC(=O)C1=CC2=C(N1)C=C(C=C2)F |