2',3'-cGAMP-C2-PPA
2',3'-cGAMP-C2-PPA (45), a cyclic dinucleotide, is a STING agonist (US20210015941A1). 2',3'-cGAMP-C2-PPA is a part of antibody-linker conjugate for ADC (drug-linker conjugate for ADC), which can be used to synthesize antibody conjugates for targeted cancer research.
| Supplier | BOC Sciences |
|---|---|
| Product # | BADC-01454 |
| Pricing | Inquire |
| Cas | 2586047-11-0 |
| Molecular Weight | 850.71 |
| Molecular Formula | C27H36N10O14P2S2 |
| Canonical SMILES | CC(CCC(=O)O)SSCCC1C2COP(=O)(OC3C(COP(=O)(OC1C(O2)N4C=NC5=C4N=C(NC5=O)N)O)OC(C3O)N6C=NC7=C(N=CN=C76)N)O |