5'-O-DMT-thymidine 3'-CE phosphoramidite
5'-O-DMT-thymidine 3'-CE phosphoramidite is an immensely critical compound employed in the solid-phase synthesis of oligonucleotides, the building blocks of DNA. The chemical is a phosphoramidite derivative of thymidine, which dutifully incorporates into the growing strand of DNA during synthesis, and crucially, in turn, dictates the eventual structure of the resultant chemical entity. As the leading-edge compound known to have tremendous potential in treating an array of viral infections and genetic diseases, this compound has opened new doors of discovery that were previously deemed unattainable.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2706-383230 |
| Pricing | Inquire |
| Cas | 98796-51-1 |
| Molecular Weight | 744.83 |
| Molecular Formula | C40H49N4O8P |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2CC(C(O2)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC)OP(N(C(C)C)C(C)C)OCCC#N |