8-Anilino-1-naphthalenesulfonic acid ammonium salt
8-Anilino-1-naphthalenesulfonic acid ammonium salt (CAS# 28836-03-5) is a fluorescent probe for protein studies. It can also be used in engineering or chemical process of broad-spectrum tunable photoluminescent nanomaterials constructed from modular light-harvesting platform based on macrocyclic amphiphiles.
| Supplier | BOC Sciences |
|---|---|
| Product # | 28836-03-5 |
| Pricing | Inquire |
| Cas | 28836-03-5 |
| Molecular Weight | 316.37 |
| Molecular Formula | C16H16N2O3S |
| Canonical SMILES | C1=CC=C(C=C1)NC2=CC=CC3=C2C(=CC=C3)S(=O)(=O)[O-].[NH4+] |