4,5-Dihydro-6-ketonorethindrone
4,5-Dihydro-6-ketonorethindrone, a synthetic steroid prominent in hormonal contraceptive and hormone replacement therapy research, displays notable anti-estrogenic properties. Its therapeutic potential extends to investigations in breast cancer and endometriosis treatment, showcasing a multifaceted application in clinical contexts.
| Supplier | BOC Sciences |
|---|---|
| Product # | 53697-08-8 |
| Pricing | Inquire |
| Cas | 53697-08-8 |
| Molecular Weight | 314.43 |
| Molecular Formula | C20H26O3 |
| Canonical SMILES | CC12CCC3C4CCC(=O)CC4C(=O)CC3C1CCC2(C#C)O |