5-Fluorocytosine arabinoside
5-Fluorocytosine arabinoside, an exceptionally powerful antineoplastic agent extensively applied for the management of diverse malignancies such as leukemia and solid tumors, expertly imparts its therapeutic effects through the restraint of DNA synthesis and the instigation of cellular demise.
| Supplier | BOC Sciences |
|---|---|
| Product # | 4298-10-6 |
| Pricing | Inquire |
| Cas | 4298-10-6 |
| Molecular Weight | 261.21 |
| Molecular Formula | C9H12FN3O5 |
| Canonical SMILES | C1=C(C(=NC(=O)N1C2C(C(C(O2)CO)O)O)N)F |