Nonyl b-D-maltopyranoside
Nonyl b-D-maltopyranoside, an invaluable compound extensively applied in the biomedical sector, demonstrates remarkable potential. Its detergent attributes guarantee its utility as a reagent in multiple drug formulations and research investigations. Integral in drug delivery systems and pharmaceutical preparations, it acts as a crucial facilitator in drug solubilization and stabilization. Moreover, its application extends to the development of therapeutic approaches targeting specific ailments, rendering it an indispensable constituent within biomedical research and drug exploration.
| Supplier | BOC Sciences |
|---|---|
| Product # | 106402-05-5 |
| Pricing | Inquire |
| Cas | 106402-05-5 |
| Molecular Weight | 468.54 |
| Molecular Formula | C21H40O11 |
| Canonical SMILES | CCCCCCCCCOC1C(C(C(C(O1)CO)OC2C(C(C(C(O2)CO)O)O)O)O)O |