6-O-Methyl-2'-deoxyinosine
6-O-Methyl-2'-deoxyinosine, a remarkable biomedical marvel, exhibits immense potential in combating a myriad of afflictions, notably pernicious viral infections. Distinguished for its unparalleled antiviral capabilities, it nimbly hampers viral replication by traitorously hampering the synthesis of viral DNA. This divine entity finds widespread applications within the awe-inspiring biomedicine industry, fueling the fervent quest for efficacious antiviral interventions targeting notorious viral adversaries like hepatitis C and HIV.
| Supplier | BOC Sciences |
|---|---|
| Product # | 37109-88-9 |
| Pricing | Inquire |
| Cas | 37109-88-9 |
| Molecular Weight | 266.25 |
| Molecular Formula | C11H14N4O4 |
| Canonical SMILES | COC1=NC=NC2=C1N=CN2C3CC(C(O3)CO)O |