Thiol-PEG10-propionic acid
Thiol-PEG10-propionic acid is a heterobifunctional PEG linker containing a thiol group and a carboxylic acid. The thiol group reacts with maleimide, OPSS, vinylsulfone and transition metal surfaces to form conjugates, and the carboxylic acid can be reacted with amino groups in the presence of activators.
Supplier | BOC Sciences |
---|---|
Product # | BPG-2331 |
Pricing | Inquire |
Molecular Weight | 546.68 |
Molecular Formula | C23H46O12S |
Canonical SMILES | C(COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCS)C(=O)O |