3',5'-O-(1,1,3,3-Tetraisopropyl-1,3-disiloxanediyl)uridine
3',5'-O-(1,1,3,3-Tetraisopropyl-1,3-disiloxanediyl)uridine, a bioactive agent synthesized for biomedical applications, demonstrates exceptional efficacy in combating specific viral infections namely, hepatitis C and respiratory syncytial virus (RSV). By exerting potent antiviral effects, this compound significantly impedes viral replication, culminating in the effective prevention and management of these viral infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | 69304-38-7 |
| Pricing | Inquire |
| Cas | 69304-38-7 |
| Molecular Weight | 486.71 |
| Molecular Formula | C21H38N2O7Si2 |
| Canonical SMILES | CC(C)[Si]1(OCC2C(C(C(O2)N3C=CC(=O)NC3=O)O)O[Si](O1)(C(C)C)C(C)C)C(C)C |