3'-O-DMT-5-Methy-Uridine-TNA 2'-CE phosphoramidite
3'-O-DMT-5-Methy-Uridine-TNA 2'-CE phosphoramidite stands as a fundamental ingredient for the in vitro selection of aptamers; RNA molecules designed for the specific capturing of target molecules, including drugs and disease biomarkers. Synthesized using this crucial element, these aptamers have enormous potential for application in both drug discovery and diagnostics research fields.
| Supplier | BOC Sciences |
|---|---|
| Product # | B1370-376750 |
| Pricing | Inquire |
| Cas | 325683-94-1 |
| Molecular Weight | 730.80 |
| Molecular Formula | C39H47N4O8P |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2C(C(CO2)OC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC)OP(N(C(C)C)C(C)C)OCCC#N |