9-(b-L-Arabinofuranosyl)guanine
9-(b-L-Arabinofuranosyl)guanine, a profoundly powerful antiviral agent, finds application in combatting an array of viral afflictions such as herpes simplex and herpes zoster. Its mechanism entails impeding viral DNA replication, impeding the proliferation and subsequent harm inflicted by the virus.
| Supplier | BOC Sciences |
|---|---|
| Product # | 469887-93-2 |
| Pricing | Inquire |
| Cas | 469887-93-2 |
| Molecular Weight | 283.24 |
| Molecular Formula | C10H13N5O5 |
| Canonical SMILES | C1=NC2=C(N1C3C(C(C(O3)CO)O)O)N=C(NC2=O)N |