2,3,6,2,3,4,6-Hepta-O-acetyl-b-D-cellobiosyl azide
2,3,6,2,3,4,6-Hepta-O-acetyl-b-D-cellobiosyl azide, a highly versatile and indispensable biomedicine product, embodies remarkable potential for advancing glycoconjugate research. With its intricate chemical configuration, this compound plays a vital role in constructing multifaceted carbohydrate structures, thereby propelling advancements in the field of complex carbohydrate synthesis. Additionally, its distinctive properties render it an invaluable tool in elucidating the intricate involvement of carbohydrates in diverse biological phenomena and facilitating the targeted delivery of therapeutic agents for combating specific diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 33012-50-9 |
| Pricing | Inquire |
| Cas | 33012-50-9 |
| Molecular Weight | 661.57 |
| Molecular Formula | C26H35N3O17 |
| Canonical SMILES | CC(=O)OCC1C(C(C(C(O1)N=[N+]=[N-])OC(=O)C)OC(=O)C)OC2C(C(C(C(O2)COC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |