tert-Butyl 5-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-ylcarbamate
tert-Butyl 5-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-ylcarbamate is a cutting-edge biomedical compound that holds immense potential in combating specific ailments. Functioning as a powerful inhibitor, this compound effectively impedes the advancement of diverse cancer forms by selectively targeting a vital protein. Displaying exceptional prowess in curbing tumor expansion and metastasis, it exhibits a distinctive chemical configuration that enables unparalleled precision and efficacy in its cellular intervention.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1105675-61-3 |
| Pricing | Inquire |
| Cas | 1105675-61-3 |
| Molecular Weight | 350.22 |
| Molecular Formula | C17H27BN2O5 |
| Canonical SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=NC=C2NC(=O)OC(C)(C)C)OC |