2'-Deoxyadenosine 5'-O-thiophosphate sodium salt
2'-Deoxyadenosine 5'-O-thiophosphate sodium salt symbolizes a paramount nucleotide analog extensively employed within the biomedical industry for research objectives. Research experts predominantly employ this remarkable compound to unravel the complexities surrounding DNA synthesis and repair mechanisms. Its implementation is further extended to the realm of investigating intricate enzyme kinetics and comprehending signal transduction pathways.
| Supplier | BOC Sciences |
|---|---|
| Product # | 64145-26-2 |
| Pricing | Inquire |
| Cas | 64145-26-2 |
| Molecular Weight | 347.29 |
| Molecular Formula | C10H14N5O5PS |
| Canonical SMILES | C1C(C(OC1N2C=NC3=C(N=CN=C32)N)COP(=S)(O)O)O |