Dexamethasone EP Impurity D (Mometasone Furoate EP Impurity L)
Dexamethasone EP Impurity D is a compound extracted from patent CN 106520896 A and RU 2532902 C1. It is an intermediate in the preparation of dexamethasone.
| Supplier | BOC Sciences |
|---|---|
| Product # | B0731-470030 |
| Pricing | Inquire |
| Cas | 24916-90-3 |
| Molecular Weight | 372.47 |
| Molecular Formula | C22H28O5 |
| Canonical SMILES | CC1CC2C3CCC4=CC(=O)C=CC4(C35C(O5)CC2(C1(C(=O)CO)O)C)C |